About 2-(3,3-difluorocyclohexyl)-1-(3-ethyl-1-methylpyrazol-5-yl)ethanone
2-(3,3-difluorocyclohexyl)-1-(3-ethyl-1-methylpyrazol-5-yl)ethanone (PubChem CID 114225673) has the molecular formula C14H20F2N2O
and a molecular weight of 270.32 g/mol. Its IUPAC name is 2-(3,3-difluorocyclohexyl)-1-(3-ethyl-1-methylpyrazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 2-(3,3-difluorocyclohexyl)-1-(3-ethyl-1-methylpyrazol-5-yl)ethanone |
| PubChem CID | 114225673 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-(3,3-difluorocyclohexyl)-1-(3-ethyl-1-methylpyrazol-5-yl)ethanone |
| SMILES | CCc1cc(C(=O)CC2CCCC(F)(F)C2)n(C)n1 |
| InChI | InChI=1S/C14H20F2N2O/c1-3-11-8-12(18(2)17-11)13(19)7-10-5-4-6-14(15,16)9-10/h8,10H,3-7,9H2,1-2H3 |
| InChIKey | BSSTUSGNQNZREL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,3-difluorocyclohexyl)-1-(3-ethyl-1-methylpyrazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-difluorocyclohexyl)-1-(3-ethyl-1-methylpyrazol-5-yl)ethanone?
The IUPAC name of 2-(3,3-difluorocyclohexyl)-1-(3-ethyl-1-methylpyrazol-5-yl)ethanone (CID 114225673) is 2-(3,3-difluorocyclohexyl)-1-(3-ethyl-1-methylpyrazol-5-yl)ethanone.
What is the SMILES notation for 2-(3,3-difluorocyclohexyl)-1-(3-ethyl-1-methylpyrazol-5-yl)ethanone?
The canonical SMILES for 2-(3,3-difluorocyclohexyl)-1-(3-ethyl-1-methylpyrazol-5-yl)ethanone is CCc1cc(C(=O)CC2CCCC(F)(F)C2)n(C)n1.
What is the InChIKey of 2-(3,3-difluorocyclohexyl)-1-(3-ethyl-1-methylpyrazol-5-yl)ethanone?
The InChIKey is BSSTUSGNQNZREL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F2N2O/c1-3-11-8-12(18(2)17-11)13(19)7-10-5-4-6-14(15,16)9-10/h8,10H,3-7,9H2,1-2H3.
What are the key properties of 2-(3,3-difluorocyclohexyl)-1-(3-ethyl-1-methylpyrazol-5-yl)ethanone?
2-(3,3-difluorocyclohexyl)-1-(3-ethyl-1-methylpyrazol-5-yl)ethanone has a molecular weight of 270.32 g/mol, XLogP of 3.38, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-difluorocyclohexyl)-1-(3-ethyl-1-methylpyrazol-5-yl)ethanone is sourced from PubChem (CID 114225673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).