About [2-(3,3-difluorocyclohexyl)-1-(2-ethyloxolan-3-yl)ethyl]hydrazine
[2-(3,3-difluorocyclohexyl)-1-(2-ethyloxolan-3-yl)ethyl]hydrazine (PubChem CID 114226053) has the molecular formula C14H26F2N2O
and a molecular weight of 276.37 g/mol. Its IUPAC name is [2-(3,3-difluorocyclohexyl)-1-(2-ethyloxolan-3-yl)ethyl]hydrazine.
Molecular Properties
| Compound Name | [2-(3,3-difluorocyclohexyl)-1-(2-ethyloxolan-3-yl)ethyl]hydrazine |
| PubChem CID | 114226053 |
| Molecular Formula | C14H26F2N2O |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | [2-(3,3-difluorocyclohexyl)-1-(2-ethyloxolan-3-yl)ethyl]hydrazine |
| SMILES | CCC1OCCC1C(CC1CCCC(F)(F)C1)NN |
| InChI | InChI=1S/C14H26F2N2O/c1-2-13-11(5-7-19-13)12(18-17)8-10-4-3-6-14(15,16)9-10/h10-13,18H,2-9,17H2,1H3 |
| InChIKey | YHQDZEKHAQRUST-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(3,3-difluorocyclohexyl)-1-(2-ethyloxolan-3-yl)ethyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,3-difluorocyclohexyl)-1-(2-ethyloxolan-3-yl)ethyl]hydrazine?
The IUPAC name of [2-(3,3-difluorocyclohexyl)-1-(2-ethyloxolan-3-yl)ethyl]hydrazine (CID 114226053) is [2-(3,3-difluorocyclohexyl)-1-(2-ethyloxolan-3-yl)ethyl]hydrazine.
What is the SMILES notation for [2-(3,3-difluorocyclohexyl)-1-(2-ethyloxolan-3-yl)ethyl]hydrazine?
The canonical SMILES for [2-(3,3-difluorocyclohexyl)-1-(2-ethyloxolan-3-yl)ethyl]hydrazine is CCC1OCCC1C(CC1CCCC(F)(F)C1)NN.
What is the InChIKey of [2-(3,3-difluorocyclohexyl)-1-(2-ethyloxolan-3-yl)ethyl]hydrazine?
The InChIKey is YHQDZEKHAQRUST-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26F2N2O/c1-2-13-11(5-7-19-13)12(18-17)8-10-4-3-6-14(15,16)9-10/h10-13,18H,2-9,17H2,1H3.
What are the key properties of [2-(3,3-difluorocyclohexyl)-1-(2-ethyloxolan-3-yl)ethyl]hydrazine?
[2-(3,3-difluorocyclohexyl)-1-(2-ethyloxolan-3-yl)ethyl]hydrazine has a molecular weight of 276.37 g/mol, XLogP of 2.85, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,3-difluorocyclohexyl)-1-(2-ethyloxolan-3-yl)ethyl]hydrazine is sourced from PubChem (CID 114226053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).