About 4-[2-chloro-2-(3,3-difluorocyclopentyl)ethyl]-6-methoxypyrimidine
4-[2-chloro-2-(3,3-difluorocyclopentyl)ethyl]-6-methoxypyrimidine (PubChem CID 114226793) has the molecular formula C12H15ClF2N2O
and a molecular weight of 276.71 g/mol. Its IUPAC name is 4-[2-chloro-2-(3,3-difluorocyclopentyl)ethyl]-6-methoxypyrimidine.
Molecular Properties
| Compound Name | 4-[2-chloro-2-(3,3-difluorocyclopentyl)ethyl]-6-methoxypyrimidine |
| PubChem CID | 114226793 |
| Molecular Formula | C12H15ClF2N2O |
| Molecular Weight | 276.71 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 4-[2-chloro-2-(3,3-difluorocyclopentyl)ethyl]-6-methoxypyrimidine |
| SMILES | COc1cc(CC(Cl)C2CCC(F)(F)C2)ncn1 |
| InChI | InChI=1S/C12H15ClF2N2O/c1-18-11-5-9(16-7-17-11)4-10(13)8-2-3-12(14,15)6-8/h5,7-8,10H,2-4,6H2,1H3 |
| InChIKey | CWHXESXKJPIFTJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.71 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-chloro-2-(3,3-difluorocyclopentyl)ethyl]-6-methoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-chloro-2-(3,3-difluorocyclopentyl)ethyl]-6-methoxypyrimidine?
The IUPAC name of 4-[2-chloro-2-(3,3-difluorocyclopentyl)ethyl]-6-methoxypyrimidine (CID 114226793) is 4-[2-chloro-2-(3,3-difluorocyclopentyl)ethyl]-6-methoxypyrimidine.
What is the SMILES notation for 4-[2-chloro-2-(3,3-difluorocyclopentyl)ethyl]-6-methoxypyrimidine?
The canonical SMILES for 4-[2-chloro-2-(3,3-difluorocyclopentyl)ethyl]-6-methoxypyrimidine is COc1cc(CC(Cl)C2CCC(F)(F)C2)ncn1.
What is the InChIKey of 4-[2-chloro-2-(3,3-difluorocyclopentyl)ethyl]-6-methoxypyrimidine?
The InChIKey is CWHXESXKJPIFTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClF2N2O/c1-18-11-5-9(16-7-17-11)4-10(13)8-2-3-12(14,15)6-8/h5,7-8,10H,2-4,6H2,1H3.
What are the key properties of 4-[2-chloro-2-(3,3-difluorocyclopentyl)ethyl]-6-methoxypyrimidine?
4-[2-chloro-2-(3,3-difluorocyclopentyl)ethyl]-6-methoxypyrimidine has a molecular weight of 276.71 g/mol, XLogP of 3.07, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-chloro-2-(3,3-difluorocyclopentyl)ethyl]-6-methoxypyrimidine is sourced from PubChem (CID 114226793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).