About 2-(benzylideneamino)-4,6-ditert-butylphenol
2-(benzylideneamino)-4,6-ditert-butylphenol (PubChem CID 11422749) has the molecular formula C21H27NO
and a molecular weight of 309.45 g/mol. Its IUPAC name is 2-(benzylideneamino)-4,6-ditert-butylphenol.
Molecular Properties
| Compound Name | 2-(benzylideneamino)-4,6-ditert-butylphenol |
| PubChem CID | 11422749 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 2-(benzylideneamino)-4,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(/N=C/c2ccccc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H27NO/c1-20(2,3)16-12-17(21(4,5)6)19(23)18(13-16)22-14-15-10-8-7-9-11-15/h7-14,23H,1-6H3/b22-14+ |
| InChIKey | NBNNVFXAPKZOAW-HYARGMPZSA-N |
| XLogP | 5.74 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(benzylideneamino)-4,6-ditert-butylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzylideneamino)-4,6-ditert-butylphenol?
The IUPAC name of 2-(benzylideneamino)-4,6-ditert-butylphenol (CID 11422749) is 2-(benzylideneamino)-4,6-ditert-butylphenol.
What is the SMILES notation for 2-(benzylideneamino)-4,6-ditert-butylphenol?
The canonical SMILES for 2-(benzylideneamino)-4,6-ditert-butylphenol is CC(C)(C)c1cc(/N=C/c2ccccc2)c(O)c(C(C)(C)C)c1.
What is the InChIKey of 2-(benzylideneamino)-4,6-ditert-butylphenol?
The InChIKey is NBNNVFXAPKZOAW-HYARGMPZSA-N. The full InChI is InChI=1S/C21H27NO/c1-20(2,3)16-12-17(21(4,5)6)19(23)18(13-16)22-14-15-10-8-7-9-11-15/h7-14,23H,1-6H3/b22-14+.
What are the key properties of 2-(benzylideneamino)-4,6-ditert-butylphenol?
2-(benzylideneamino)-4,6-ditert-butylphenol has a molecular weight of 309.45 g/mol, XLogP of 5.74, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzylideneamino)-4,6-ditert-butylphenol is sourced from PubChem (CID 11422749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).