C11H24N2O3S — CID 114227646
4-amino-3-ethoxy-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)butanamide (PubChem CID 114227646) has the molecular formula C11H24N2O3S and a molecular weight of 264.39 g/mol. Its IUPAC name is 4-amino-3-ethoxy-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)butanamide.
| Compound Name | 4-amino-3-ethoxy-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)butanamide |
|---|---|
| PubChem CID | 114227646 |
| Molecular Formula | C11H24N2O3S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 4-amino-3-ethoxy-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)butanamide |
| SMILES | CCOC(CN)CC(=O)NCC(C)(O)CSC |
| InChI | InChI=1S/C11H24N2O3S/c1-4-16-9(6-12)5-10(14)13-7-11(2,15)8-17-3/h9,15H,4-8,12H2,1-3H3,(H,13,14) |
| InChIKey | YFBFUHDIZJTQOO-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |