C16H20O2S — CID 114227721
5-[(2E)-cyclooct-2-en-1-yl]sulfanyl-2-methylbenzoic acid (PubChem CID 114227721) has the molecular formula C16H20O2S and a molecular weight of 276.40 g/mol. Its IUPAC name is 5-[(2E)-cyclooct-2-en-1-yl]sulfanyl-2-methylbenzoic acid.
| Compound Name | 5-[(2E)-cyclooct-2-en-1-yl]sulfanyl-2-methylbenzoic acid |
|---|---|
| PubChem CID | 114227721 |
| Molecular Formula | C16H20O2S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 5-[(2E)-cyclooct-2-en-1-yl]sulfanyl-2-methylbenzoic acid |
| SMILES | Cc1ccc(SC2/C=C\CCCCC2)cc1C(=O)O |
| InChI | InChI=1S/C16H20O2S/c1-12-9-10-14(11-15(12)16(17)18)19-13-7-5-3-2-4-6-8-13/h5,7,9-11,13H,2-4,6,8H2,1H3,(H,17,18)/b7-5- |
| InChIKey | LERGZRAOBIQLDX-ALCCZGGFSA-N |
| XLogP | 4.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|