C14H29NO3 — CID 114229284
4-methoxy-1-(3-methoxy-3-methylpiperidin-1-yl)-4-methylpentan-3-ol (PubChem CID 114229284) has the molecular formula C14H29NO3 and a molecular weight of 259.39 g/mol. Its IUPAC name is 4-methoxy-1-(3-methoxy-3-methylpiperidin-1-yl)-4-methylpentan-3-ol.
| Compound Name | 4-methoxy-1-(3-methoxy-3-methylpiperidin-1-yl)-4-methylpentan-3-ol |
|---|---|
| PubChem CID | 114229284 |
| Molecular Formula | C14H29NO3 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | 4-methoxy-1-(3-methoxy-3-methylpiperidin-1-yl)-4-methylpentan-3-ol |
| SMILES | COC1(C)CCCN(CCC(O)C(C)(C)OC)C1 |
| InChI | InChI=1S/C14H29NO3/c1-13(2,17-4)12(16)7-10-15-9-6-8-14(3,11-15)18-5/h12,16H,6-11H2,1-5H3 |
| InChIKey | LYBQOKIHWLDBRL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |