About N-[[3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methyl]propan-2-amine
N-[[3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methyl]propan-2-amine (PubChem CID 114229668) has the molecular formula C15H22BrN
and a molecular weight of 296.25 g/mol. Its IUPAC name is N-[[3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[[3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methyl]propan-2-amine |
| PubChem CID | 114229668 |
| Molecular Formula | C15H22BrN |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | N-[[3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methyl]propan-2-amine |
| SMILES | CC(C)NCC1C(c2ccc(Br)cc2)C1(C)C |
| InChI | InChI=1S/C15H22BrN/c1-10(2)17-9-13-14(15(13,3)4)11-5-7-12(16)8-6-11/h5-8,10,13-14,17H,9H2,1-4H3 |
| InChIKey | ICBGXUNCZMBBFF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[[3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methyl]propan-2-amine?
The IUPAC name of N-[[3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methyl]propan-2-amine (CID 114229668) is N-[[3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methyl]propan-2-amine.
What is the SMILES notation for N-[[3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methyl]propan-2-amine?
The canonical SMILES for N-[[3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methyl]propan-2-amine is CC(C)NCC1C(c2ccc(Br)cc2)C1(C)C.
What is the InChIKey of N-[[3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methyl]propan-2-amine?
The InChIKey is ICBGXUNCZMBBFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22BrN/c1-10(2)17-9-13-14(15(13,3)4)11-5-7-12(16)8-6-11/h5-8,10,13-14,17H,9H2,1-4H3.
What are the key properties of N-[[3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methyl]propan-2-amine?
N-[[3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methyl]propan-2-amine has a molecular weight of 296.25 g/mol, XLogP of 4.19, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-(4-bromophenyl)-2,2-dimethylcyclopropyl]methyl]propan-2-amine is sourced from PubChem (CID 114229668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).