About N-[(2,2-dimethyl-6,6-dioxo-6λ6-thiaspiro[2.5]octan-1-yl)methyl]-2-methoxyethanamine
N-[(2,2-dimethyl-6,6-dioxo-6λ6-thiaspiro[2.5]octan-1-yl)methyl]-2-methoxyethanamine (PubChem CID 114229894) has the molecular formula C13H25NO3S
and a molecular weight of 275.41 g/mol. Its IUPAC name is N-[(2,2-dimethyl-6,6-dioxo-6λ6-thiaspiro[2.5]octan-1-yl)methyl]-2-methoxyethanamine.
Molecular Properties
| Compound Name | N-[(2,2-dimethyl-6,6-dioxo-6λ6-thiaspiro[2.5]octan-1-yl)methyl]-2-methoxyethanamine |
| PubChem CID | 114229894 |
| Molecular Formula | C13H25NO3S |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | N-[(2,2-dimethyl-6,6-dioxo-6λ6-thiaspiro[2.5]octan-1-yl)methyl]-2-methoxyethanamine |
| SMILES | COCCNCC1C(C)(C)C12CCS(=O)(=O)CC2 |
| InChI | InChI=1S/C13H25NO3S/c1-12(2)11(10-14-6-7-17-3)13(12)4-8-18(15,16)9-5-13/h11,14H,4-10H2,1-3H3 |
| InChIKey | KBWCKBJHCCQRPY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(2,2-dimethyl-6,6-dioxo-6λ6-thiaspiro[2.5]octan-1-yl)methyl]-2-methoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,2-dimethyl-6,6-dioxo-6λ6-thiaspiro[2.5]octan-1-yl)methyl]-2-methoxyethanamine?
The IUPAC name of N-[(2,2-dimethyl-6,6-dioxo-6λ6-thiaspiro[2.5]octan-1-yl)methyl]-2-methoxyethanamine (CID 114229894) is N-[(2,2-dimethyl-6,6-dioxo-6λ6-thiaspiro[2.5]octan-1-yl)methyl]-2-methoxyethanamine.
What is the SMILES notation for N-[(2,2-dimethyl-6,6-dioxo-6λ6-thiaspiro[2.5]octan-1-yl)methyl]-2-methoxyethanamine?
The canonical SMILES for N-[(2,2-dimethyl-6,6-dioxo-6λ6-thiaspiro[2.5]octan-1-yl)methyl]-2-methoxyethanamine is COCCNCC1C(C)(C)C12CCS(=O)(=O)CC2.
What is the InChIKey of N-[(2,2-dimethyl-6,6-dioxo-6λ6-thiaspiro[2.5]octan-1-yl)methyl]-2-methoxyethanamine?
The InChIKey is KBWCKBJHCCQRPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO3S/c1-12(2)11(10-14-6-7-17-3)13(12)4-8-18(15,16)9-5-13/h11,14H,4-10H2,1-3H3.
What are the key properties of N-[(2,2-dimethyl-6,6-dioxo-6λ6-thiaspiro[2.5]octan-1-yl)methyl]-2-methoxyethanamine?
N-[(2,2-dimethyl-6,6-dioxo-6λ6-thiaspiro[2.5]octan-1-yl)methyl]-2-methoxyethanamine has a molecular weight of 275.41 g/mol, XLogP of 1.07, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,2-dimethyl-6,6-dioxo-6λ6-thiaspiro[2.5]octan-1-yl)methyl]-2-methoxyethanamine is sourced from PubChem (CID 114229894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).