About 4-Bromo-2-methylaniline
4-Bromo-2-methylaniline (PubChem CID 11423) has the molecular formula C7H8BrN
and a molecular weight of 186.05 g/mol. Its IUPAC name is 4-bromo-2-methylaniline.
Molecular Properties
| Compound Name | 4-Bromo-2-methylaniline |
| PubChem CID | 11423 |
| Molecular Formula | C7H8BrN |
| Molecular Weight | 186.05 g/mol |
| Exact Mass | 184.98 |
| IUPAC Name | 4-bromo-2-methylaniline |
| SMILES | CC1=C(C=CC(=C1)Br)N |
| InChI | InChI=1S/C7H8BrN/c1-5-4-6(8)2-3-7(5)9/h2-4H,9H2,1H3 |
| InChIKey | PCHYYOCUCGCSBU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | 94 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.05 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-Bromo-2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Bromo-2-methylaniline?
The IUPAC name of 4-Bromo-2-methylaniline (CID 11423) is 4-bromo-2-methylaniline.
What is the SMILES notation for 4-Bromo-2-methylaniline?
The canonical SMILES for 4-Bromo-2-methylaniline is CC1=C(C=CC(=C1)Br)N.
What is the InChIKey of 4-Bromo-2-methylaniline?
The InChIKey is PCHYYOCUCGCSBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrN/c1-5-4-6(8)2-3-7(5)9/h2-4H,9H2,1H3.
What are the key properties of 4-Bromo-2-methylaniline?
4-Bromo-2-methylaniline has a molecular weight of 186.05 g/mol, XLogP of 1.90, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Bromo-2-methylaniline is sourced from PubChem (CID 11423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).