C12H16Cl2N2O2 — CID 114230839
N-(2,3-dichlorophenyl)-2-[3-hydroxypropyl(methyl)amino]acetamide (PubChem CID 114230839) has the molecular formula C12H16Cl2N2O2 and a molecular weight of 291.18 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[3-hydroxypropyl(methyl)amino]acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[3-hydroxypropyl(methyl)amino]acetamide |
|---|---|
| PubChem CID | 114230839 |
| Molecular Formula | C12H16Cl2N2O2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[3-hydroxypropyl(methyl)amino]acetamide |
| SMILES | CN(CCCO)CC(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H16Cl2N2O2/c1-16(6-3-7-17)8-11(18)15-10-5-2-4-9(13)12(10)14/h2,4-5,17H,3,6-8H2,1H3,(H,15,18) |
| InChIKey | GRDWTVNTVLKYCD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |