C11H18N4O2 — CID 114230990
2-[[3-hydroxypropyl(methyl)amino]methyl]pyridine-3-carbohydrazide (PubChem CID 114230990) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-[[3-hydroxypropyl(methyl)amino]methyl]pyridine-3-carbohydrazide.
| Compound Name | 2-[[3-hydroxypropyl(methyl)amino]methyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 114230990 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 2-[[3-hydroxypropyl(methyl)amino]methyl]pyridine-3-carbohydrazide |
| SMILES | CN(CCCO)Cc1ncccc1C(=O)NN |
| InChI | InChI=1S/C11H18N4O2/c1-15(6-3-7-16)8-10-9(11(17)14-12)4-2-5-13-10/h2,4-5,16H,3,6-8,12H2,1H3,(H,14,17) |
| InChIKey | MYEITWKNEYQZAW-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|