About 3-amino-N-cyclopropyl-5-[3-hydroxypropyl(methyl)amino]-1,2-thiazole-4-carboxamide
3-amino-N-cyclopropyl-5-[3-hydroxypropyl(methyl)amino]-1,2-thiazole-4-carboxamide (PubChem CID 114231035) has the molecular formula C11H18N4O2S
and a molecular weight of 270.36 g/mol. Its IUPAC name is 3-amino-N-cyclopropyl-5-[3-hydroxypropyl(methyl)amino]-1,2-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-amino-N-cyclopropyl-5-[3-hydroxypropyl(methyl)amino]-1,2-thiazole-4-carboxamide |
| PubChem CID | 114231035 |
| Molecular Formula | C11H18N4O2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 3-amino-N-cyclopropyl-5-[3-hydroxypropyl(methyl)amino]-1,2-thiazole-4-carboxamide |
| SMILES | CN(CCCO)c1snc(N)c1C(=O)NC1CC1 |
| InChI | InChI=1S/C11H18N4O2S/c1-15(5-2-6-16)11-8(9(12)14-18-11)10(17)13-7-3-4-7/h7,16H,2-6H2,1H3,(H2,12,14)(H,13,17) |
| InChIKey | BLYPRTKBNQCIEF-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-amino-N-cyclopropyl-5-[3-hydroxypropyl(methyl)amino]-1,2-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-cyclopropyl-5-[3-hydroxypropyl(methyl)amino]-1,2-thiazole-4-carboxamide?
The IUPAC name of 3-amino-N-cyclopropyl-5-[3-hydroxypropyl(methyl)amino]-1,2-thiazole-4-carboxamide (CID 114231035) is 3-amino-N-cyclopropyl-5-[3-hydroxypropyl(methyl)amino]-1,2-thiazole-4-carboxamide.
What is the SMILES notation for 3-amino-N-cyclopropyl-5-[3-hydroxypropyl(methyl)amino]-1,2-thiazole-4-carboxamide?
The canonical SMILES for 3-amino-N-cyclopropyl-5-[3-hydroxypropyl(methyl)amino]-1,2-thiazole-4-carboxamide is CN(CCCO)c1snc(N)c1C(=O)NC1CC1.
What is the InChIKey of 3-amino-N-cyclopropyl-5-[3-hydroxypropyl(methyl)amino]-1,2-thiazole-4-carboxamide?
The InChIKey is BLYPRTKBNQCIEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O2S/c1-15(5-2-6-16)11-8(9(12)14-18-11)10(17)13-7-3-4-7/h7,16H,2-6H2,1H3,(H2,12,14)(H,13,17).
What are the key properties of 3-amino-N-cyclopropyl-5-[3-hydroxypropyl(methyl)amino]-1,2-thiazole-4-carboxamide?
3-amino-N-cyclopropyl-5-[3-hydroxypropyl(methyl)amino]-1,2-thiazole-4-carboxamide has a molecular weight of 270.36 g/mol, XLogP of 0.44, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-cyclopropyl-5-[3-hydroxypropyl(methyl)amino]-1,2-thiazole-4-carboxamide is sourced from PubChem (CID 114231035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).