C12H24N2O3S — CID 114232833
2-[2-(ethylamino)cyclohexyl]sulfonyl-N,N-dimethylacetamide (PubChem CID 114232833) has the molecular formula C12H24N2O3S and a molecular weight of 276.40 g/mol. Its IUPAC name is 2-[2-(ethylamino)cyclohexyl]sulfonyl-N,N-dimethylacetamide.
| Compound Name | 2-[2-(ethylamino)cyclohexyl]sulfonyl-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 114232833 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-[2-(ethylamino)cyclohexyl]sulfonyl-N,N-dimethylacetamide |
| SMILES | CCNC1CCCCC1S(=O)(=O)CC(=O)N(C)C |
| InChI | InChI=1S/C12H24N2O3S/c1-4-13-10-7-5-6-8-11(10)18(16,17)9-12(15)14(2)3/h10-11,13H,4-9H2,1-3H3 |
| InChIKey | SNHSSVBSSAGKDU-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |