About 2-[2-(aminomethyl)-3,3,3-trifluoropropyl]sulfonyl-N-propylacetamide
2-[2-(aminomethyl)-3,3,3-trifluoropropyl]sulfonyl-N-propylacetamide (PubChem CID 114233401) has the molecular formula C9H17F3N2O3S
and a molecular weight of 290.31 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-3,3,3-trifluoropropyl]sulfonyl-N-propylacetamide.
Molecular Properties
| Compound Name | 2-[2-(aminomethyl)-3,3,3-trifluoropropyl]sulfonyl-N-propylacetamide |
| PubChem CID | 114233401 |
| Molecular Formula | C9H17F3N2O3S |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-[2-(aminomethyl)-3,3,3-trifluoropropyl]sulfonyl-N-propylacetamide |
| SMILES | CCCNC(=O)CS(=O)(=O)CC(CN)C(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O3S/c1-2-3-14-8(15)6-18(16,17)5-7(4-13)9(10,11)12/h7H,2-6,13H2,1H3,(H,14,15) |
| InChIKey | VPUPNKZAACZLBA-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(aminomethyl)-3,3,3-trifluoropropyl]sulfonyl-N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(aminomethyl)-3,3,3-trifluoropropyl]sulfonyl-N-propylacetamide?
The IUPAC name of 2-[2-(aminomethyl)-3,3,3-trifluoropropyl]sulfonyl-N-propylacetamide (CID 114233401) is 2-[2-(aminomethyl)-3,3,3-trifluoropropyl]sulfonyl-N-propylacetamide.
What is the SMILES notation for 2-[2-(aminomethyl)-3,3,3-trifluoropropyl]sulfonyl-N-propylacetamide?
The canonical SMILES for 2-[2-(aminomethyl)-3,3,3-trifluoropropyl]sulfonyl-N-propylacetamide is CCCNC(=O)CS(=O)(=O)CC(CN)C(F)(F)F.
What is the InChIKey of 2-[2-(aminomethyl)-3,3,3-trifluoropropyl]sulfonyl-N-propylacetamide?
The InChIKey is VPUPNKZAACZLBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3N2O3S/c1-2-3-14-8(15)6-18(16,17)5-7(4-13)9(10,11)12/h7H,2-6,13H2,1H3,(H,14,15).
What are the key properties of 2-[2-(aminomethyl)-3,3,3-trifluoropropyl]sulfonyl-N-propylacetamide?
2-[2-(aminomethyl)-3,3,3-trifluoropropyl]sulfonyl-N-propylacetamide has a molecular weight of 290.31 g/mol, XLogP of 0.06, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(aminomethyl)-3,3,3-trifluoropropyl]sulfonyl-N-propylacetamide is sourced from PubChem (CID 114233401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).