About 2-[[1-(2-amino-2-iminoethyl)cyclopropyl]methylsulfanyl]-N,N-diethylacetamide
2-[[1-(2-amino-2-iminoethyl)cyclopropyl]methylsulfanyl]-N,N-diethylacetamide (PubChem CID 114233820) has the molecular formula C12H23N3OS
and a molecular weight of 257.40 g/mol. Its IUPAC name is 2-[[1-(2-amino-2-iminoethyl)cyclopropyl]methylsulfanyl]-N,N-diethylacetamide.
Molecular Properties
| Compound Name | 2-[[1-(2-amino-2-iminoethyl)cyclopropyl]methylsulfanyl]-N,N-diethylacetamide |
| PubChem CID | 114233820 |
| Molecular Formula | C12H23N3OS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 2-[[1-(2-amino-2-iminoethyl)cyclopropyl]methylsulfanyl]-N,N-diethylacetamide |
| SMILES | [H]/N=C(\N)CC1(CSCC(=O)N(CC)CC)CC1 |
| InChI | InChI=1S/C12H23N3OS/c1-3-15(4-2)11(16)8-17-9-12(5-6-12)7-10(13)14/h3-9H2,1-2H3,(H3,13,14) |
| InChIKey | LHXFHPIGFUQLAK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[1-(2-amino-2-iminoethyl)cyclopropyl]methylsulfanyl]-N,N-diethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(2-amino-2-iminoethyl)cyclopropyl]methylsulfanyl]-N,N-diethylacetamide?
The IUPAC name of 2-[[1-(2-amino-2-iminoethyl)cyclopropyl]methylsulfanyl]-N,N-diethylacetamide (CID 114233820) is 2-[[1-(2-amino-2-iminoethyl)cyclopropyl]methylsulfanyl]-N,N-diethylacetamide.
What is the SMILES notation for 2-[[1-(2-amino-2-iminoethyl)cyclopropyl]methylsulfanyl]-N,N-diethylacetamide?
The canonical SMILES for 2-[[1-(2-amino-2-iminoethyl)cyclopropyl]methylsulfanyl]-N,N-diethylacetamide is [H]/N=C(\N)CC1(CSCC(=O)N(CC)CC)CC1.
What is the InChIKey of 2-[[1-(2-amino-2-iminoethyl)cyclopropyl]methylsulfanyl]-N,N-diethylacetamide?
The InChIKey is LHXFHPIGFUQLAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3OS/c1-3-15(4-2)11(16)8-17-9-12(5-6-12)7-10(13)14/h3-9H2,1-2H3,(H3,13,14).
What are the key properties of 2-[[1-(2-amino-2-iminoethyl)cyclopropyl]methylsulfanyl]-N,N-diethylacetamide?
2-[[1-(2-amino-2-iminoethyl)cyclopropyl]methylsulfanyl]-N,N-diethylacetamide has a molecular weight of 257.40 g/mol, XLogP of 1.69, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(2-amino-2-iminoethyl)cyclopropyl]methylsulfanyl]-N,N-diethylacetamide is sourced from PubChem (CID 114233820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).