About 4-[(2,5-difluorophenyl)methyl]-3,3-dimethylpiperidin-4-ol
4-[(2,5-difluorophenyl)methyl]-3,3-dimethylpiperidin-4-ol (PubChem CID 114235620) has the molecular formula C14H19F2NO
and a molecular weight of 255.31 g/mol. Its IUPAC name is 4-[(2,5-difluorophenyl)methyl]-3,3-dimethylpiperidin-4-ol.
Molecular Properties
| Compound Name | 4-[(2,5-difluorophenyl)methyl]-3,3-dimethylpiperidin-4-ol |
| PubChem CID | 114235620 |
| Molecular Formula | C14H19F2NO |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 4-[(2,5-difluorophenyl)methyl]-3,3-dimethylpiperidin-4-ol |
| SMILES | CC1(C)CNCCC1(O)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C14H19F2NO/c1-13(2)9-17-6-5-14(13,18)8-10-7-11(15)3-4-12(10)16/h3-4,7,17-18H,5-6,8-9H2,1-2H3 |
| InChIKey | JTIYMFWLXMMHIJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(2,5-difluorophenyl)methyl]-3,3-dimethylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,5-difluorophenyl)methyl]-3,3-dimethylpiperidin-4-ol?
The IUPAC name of 4-[(2,5-difluorophenyl)methyl]-3,3-dimethylpiperidin-4-ol (CID 114235620) is 4-[(2,5-difluorophenyl)methyl]-3,3-dimethylpiperidin-4-ol.
What is the SMILES notation for 4-[(2,5-difluorophenyl)methyl]-3,3-dimethylpiperidin-4-ol?
The canonical SMILES for 4-[(2,5-difluorophenyl)methyl]-3,3-dimethylpiperidin-4-ol is CC1(C)CNCCC1(O)Cc1cc(F)ccc1F.
What is the InChIKey of 4-[(2,5-difluorophenyl)methyl]-3,3-dimethylpiperidin-4-ol?
The InChIKey is JTIYMFWLXMMHIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F2NO/c1-13(2)9-17-6-5-14(13,18)8-10-7-11(15)3-4-12(10)16/h3-4,7,17-18H,5-6,8-9H2,1-2H3.
What are the key properties of 4-[(2,5-difluorophenyl)methyl]-3,3-dimethylpiperidin-4-ol?
4-[(2,5-difluorophenyl)methyl]-3,3-dimethylpiperidin-4-ol has a molecular weight of 255.31 g/mol, XLogP of 2.26, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,5-difluorophenyl)methyl]-3,3-dimethylpiperidin-4-ol is sourced from PubChem (CID 114235620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).