C13H16F3NO — CID 114235637
3,3-dimethyl-4-(2,3,4-trifluorophenyl)piperidin-4-ol (PubChem CID 114235637) has the molecular formula C13H16F3NO and a molecular weight of 259.27 g/mol. Its IUPAC name is 3,3-dimethyl-4-(2,3,4-trifluorophenyl)piperidin-4-ol.
| Compound Name | 3,3-dimethyl-4-(2,3,4-trifluorophenyl)piperidin-4-ol |
|---|---|
| PubChem CID | 114235637 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 3,3-dimethyl-4-(2,3,4-trifluorophenyl)piperidin-4-ol |
| SMILES | CC1(C)CNCCC1(O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H16F3NO/c1-12(2)7-17-6-5-13(12,18)8-3-4-9(14)11(16)10(8)15/h3-4,17-18H,5-7H2,1-2H3 |
| InChIKey | GQDATPAABSPRAM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|