About 4-[4-(aminomethyl)oxan-4-yl]-3,3-dimethylpiperidin-4-ol
4-[4-(aminomethyl)oxan-4-yl]-3,3-dimethylpiperidin-4-ol (PubChem CID 114235679) has the molecular formula C13H26N2O2
and a molecular weight of 242.36 g/mol. Its IUPAC name is 4-[4-(aminomethyl)oxan-4-yl]-3,3-dimethylpiperidin-4-ol.
Molecular Properties
| Compound Name | 4-[4-(aminomethyl)oxan-4-yl]-3,3-dimethylpiperidin-4-ol |
| PubChem CID | 114235679 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 4-[4-(aminomethyl)oxan-4-yl]-3,3-dimethylpiperidin-4-ol |
| SMILES | CC1(C)CNCCC1(O)C1(CN)CCOCC1 |
| InChI | InChI=1S/C13H26N2O2/c1-11(2)10-15-6-3-13(11,16)12(9-14)4-7-17-8-5-12/h15-16H,3-10,14H2,1-2H3 |
| InChIKey | XSWWKNVKURRYLO-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-(aminomethyl)oxan-4-yl]-3,3-dimethylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(aminomethyl)oxan-4-yl]-3,3-dimethylpiperidin-4-ol?
The IUPAC name of 4-[4-(aminomethyl)oxan-4-yl]-3,3-dimethylpiperidin-4-ol (CID 114235679) is 4-[4-(aminomethyl)oxan-4-yl]-3,3-dimethylpiperidin-4-ol.
What is the SMILES notation for 4-[4-(aminomethyl)oxan-4-yl]-3,3-dimethylpiperidin-4-ol?
The canonical SMILES for 4-[4-(aminomethyl)oxan-4-yl]-3,3-dimethylpiperidin-4-ol is CC1(C)CNCCC1(O)C1(CN)CCOCC1.
What is the InChIKey of 4-[4-(aminomethyl)oxan-4-yl]-3,3-dimethylpiperidin-4-ol?
The InChIKey is XSWWKNVKURRYLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O2/c1-11(2)10-15-6-3-13(11,16)12(9-14)4-7-17-8-5-12/h15-16H,3-10,14H2,1-2H3.
What are the key properties of 4-[4-(aminomethyl)oxan-4-yl]-3,3-dimethylpiperidin-4-ol?
4-[4-(aminomethyl)oxan-4-yl]-3,3-dimethylpiperidin-4-ol has a molecular weight of 242.36 g/mol, XLogP of 0.49, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(aminomethyl)oxan-4-yl]-3,3-dimethylpiperidin-4-ol is sourced from PubChem (CID 114235679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).