C13H26N2O2 — CID 114235679
4-[4-(aminomethyl)oxan-4-yl]-3,3-dimethylpiperidin-4-ol (PubChem CID 114235679) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 4-[4-(aminomethyl)oxan-4-yl]-3,3-dimethylpiperidin-4-ol.
| Compound Name | 4-[4-(aminomethyl)oxan-4-yl]-3,3-dimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 114235679 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 4-[4-(aminomethyl)oxan-4-yl]-3,3-dimethylpiperidin-4-ol |
| SMILES | CC1(C)CNCCC1(O)C1(CN)CCOCC1 |
| InChI | InChI=1S/C13H26N2O2/c1-11(2)10-15-6-3-13(11,16)12(9-14)4-7-17-8-5-12/h15-16H,3-10,14H2,1-2H3 |
| InChIKey | XSWWKNVKURRYLO-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |