C13H27N3O — CID 114235692
2-[4-(3,3-dimethylpiperidin-4-yl)piperazin-1-yl]ethanol (PubChem CID 114235692) has the molecular formula C13H27N3O and a molecular weight of 241.38 g/mol. Its IUPAC name is 2-[4-(3,3-dimethylpiperidin-4-yl)piperazin-1-yl]ethanol.
| Compound Name | 2-[4-(3,3-dimethylpiperidin-4-yl)piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 114235692 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | 2-[4-(3,3-dimethylpiperidin-4-yl)piperazin-1-yl]ethanol |
| SMILES | CC1(C)CNCCC1N1CCN(CCO)CC1 |
| InChI | InChI=1S/C13H27N3O/c1-13(2)11-14-4-3-12(13)16-7-5-15(6-8-16)9-10-17/h12,14,17H,3-11H2,1-2H3 |
| InChIKey | OKRXFNLIUIZXFQ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |