C13H19FN2OS — CID 114236428
3-amino-5-fluoro-N,4-dimethyl-N-(3-methylsulfanylpropyl)benzamide (PubChem CID 114236428) has the molecular formula C13H19FN2OS and a molecular weight of 270.37 g/mol. Its IUPAC name is 3-amino-5-fluoro-N,4-dimethyl-N-(3-methylsulfanylpropyl)benzamide.
| Compound Name | 3-amino-5-fluoro-N,4-dimethyl-N-(3-methylsulfanylpropyl)benzamide |
|---|---|
| PubChem CID | 114236428 |
| Molecular Formula | C13H19FN2OS |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 3-amino-5-fluoro-N,4-dimethyl-N-(3-methylsulfanylpropyl)benzamide |
| SMILES | CSCCCN(C)C(=O)c1cc(N)c(C)c(F)c1 |
| InChI | InChI=1S/C13H19FN2OS/c1-9-11(14)7-10(8-12(9)15)13(17)16(2)5-4-6-18-3/h7-8H,4-6,15H2,1-3H3 |
| InChIKey | IVHNIGDDQQEFLI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|