C20H28N2OS — CID 114236746
N-methyl-N-(3-methylsulfanylpropyl)-1-(4-phenylmethoxyphenyl)ethane-1,2-diamine (PubChem CID 114236746) has the molecular formula C20H28N2OS and a molecular weight of 344.52 g/mol. Its IUPAC name is N-methyl-N-(3-methylsulfanylpropyl)-1-(4-phenylmethoxyphenyl)ethane-1,2-diamine.
| Compound Name | N-methyl-N-(3-methylsulfanylpropyl)-1-(4-phenylmethoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 114236746 |
| Molecular Formula | C20H28N2OS |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | N-methyl-N-(3-methylsulfanylpropyl)-1-(4-phenylmethoxyphenyl)ethane-1,2-diamine |
| SMILES | CSCCCN(C)C(CN)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H28N2OS/c1-22(13-6-14-24-2)20(15-21)18-9-11-19(12-10-18)23-16-17-7-4-3-5-8-17/h3-5,7-12,20H,6,13-16,21H2,1-2H3 |
| InChIKey | MDZWHOMXTJPJLX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|