About 1-azaspiro[5.5]undeca-4,10-diene
1-azaspiro[5.5]undeca-4,10-diene (PubChem CID 11423682) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 1-azaspiro[5.5]undeca-4,10-diene.
Molecular Properties
| Compound Name | 1-azaspiro[5.5]undeca-4,10-diene |
| PubChem CID | 11423682 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 1-azaspiro[5.5]undeca-4,10-diene |
| SMILES | C1=CC2(C=CCCN2)CCC1 |
| InChI | InChI=1S/C10H15N/c1-2-6-10(7-3-1)8-4-5-9-11-10/h2,4,6,8,11H,1,3,5,7,9H2 |
| InChIKey | FNIPMDNLTOGJBN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-azaspiro[5.5]undeca-4,10-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azaspiro[5.5]undeca-4,10-diene?
The IUPAC name of 1-azaspiro[5.5]undeca-4,10-diene (CID 11423682) is 1-azaspiro[5.5]undeca-4,10-diene.
What is the SMILES notation for 1-azaspiro[5.5]undeca-4,10-diene?
The canonical SMILES for 1-azaspiro[5.5]undeca-4,10-diene is C1=CC2(C=CCCN2)CCC1.
What is the InChIKey of 1-azaspiro[5.5]undeca-4,10-diene?
The InChIKey is FNIPMDNLTOGJBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-2-6-10(7-3-1)8-4-5-9-11-10/h2,4,6,8,11H,1,3,5,7,9H2.
What are the key properties of 1-azaspiro[5.5]undeca-4,10-diene?
1-azaspiro[5.5]undeca-4,10-diene has a molecular weight of 149.24 g/mol, XLogP of 2.01, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azaspiro[5.5]undeca-4,10-diene is sourced from PubChem (CID 11423682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).