C10H17N — CID 11423694
(5S,8aR)-5-methyl-7-methylidene-2,3,5,6,8,8a-hexahydro-1H-indolizine (PubChem CID 11423694) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (5S,8aR)-5-methyl-7-methylidene-2,3,5,6,8,8a-hexahydro-1H-indolizine.
| Compound Name | (5S,8aR)-5-methyl-7-methylidene-2,3,5,6,8,8a-hexahydro-1H-indolizine |
|---|---|
| PubChem CID | 11423694 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (5S,8aR)-5-methyl-7-methylidene-2,3,5,6,8,8a-hexahydro-1H-indolizine |
| SMILES | C=C1C[C@H]2CCCN2[C@@H](C)C1 |
| InChI | InChI=1S/C10H17N/c1-8-6-9(2)11-5-3-4-10(11)7-8/h9-10H,1,3-7H2,2H3/t9-,10+/m0/s1 |
| InChIKey | GCLSRBRHKCXLTO-VHSXEESVSA-N |
| XLogP | 2.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|