C14H26N2OS — CID 114237027
(4-methylsulfanylpiperidin-1-yl)-(3-propan-2-ylpyrrolidin-3-yl)methanone (PubChem CID 114237027) has the molecular formula C14H26N2OS and a molecular weight of 270.44 g/mol. Its IUPAC name is (4-methylsulfanylpiperidin-1-yl)-(3-propan-2-ylpyrrolidin-3-yl)methanone.
| Compound Name | (4-methylsulfanylpiperidin-1-yl)-(3-propan-2-ylpyrrolidin-3-yl)methanone |
|---|---|
| PubChem CID | 114237027 |
| Molecular Formula | C14H26N2OS |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (4-methylsulfanylpiperidin-1-yl)-(3-propan-2-ylpyrrolidin-3-yl)methanone |
| SMILES | CSC1CCN(C(=O)C2(C(C)C)CCNC2)CC1 |
| InChI | InChI=1S/C14H26N2OS/c1-11(2)14(6-7-15-10-14)13(17)16-8-4-12(18-3)5-9-16/h11-12,15H,4-10H2,1-3H3 |
| InChIKey | KZFGMWDBTLUKNZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |