C12H24N2OS2 — CID 114237236
2-carbamothioyl-2-ethyl-N-methyl-N-(3-methylsulfanylpropyl)butanamide (PubChem CID 114237236) has the molecular formula C12H24N2OS2 and a molecular weight of 276.47 g/mol. Its IUPAC name is 2-carbamothioyl-2-ethyl-N-methyl-N-(3-methylsulfanylpropyl)butanamide.
| Compound Name | 2-carbamothioyl-2-ethyl-N-methyl-N-(3-methylsulfanylpropyl)butanamide |
|---|---|
| PubChem CID | 114237236 |
| Molecular Formula | C12H24N2OS2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-carbamothioyl-2-ethyl-N-methyl-N-(3-methylsulfanylpropyl)butanamide |
| SMILES | CCC(CC)(C(=O)N(C)CCCSC)C(N)=S |
| InChI | InChI=1S/C12H24N2OS2/c1-5-12(6-2,10(13)16)11(15)14(3)8-7-9-17-4/h5-9H2,1-4H3,(H2,13,16) |
| InChIKey | DFHPGMFOTGBIPM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|