C12H23N3S2 — CID 114237921
5-[[methyl(3-methylsulfanylpropyl)amino]methyl]-N-propyl-1,3-thiazol-2-amine (PubChem CID 114237921) has the molecular formula C12H23N3S2 and a molecular weight of 273.47 g/mol. Its IUPAC name is 5-[[methyl(3-methylsulfanylpropyl)amino]methyl]-N-propyl-1,3-thiazol-2-amine.
| Compound Name | 5-[[methyl(3-methylsulfanylpropyl)amino]methyl]-N-propyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 114237921 |
| Molecular Formula | C12H23N3S2 |
| Molecular Weight | 273.47 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 5-[[methyl(3-methylsulfanylpropyl)amino]methyl]-N-propyl-1,3-thiazol-2-amine |
| SMILES | CCCNc1ncc(CN(C)CCCSC)s1 |
| InChI | InChI=1S/C12H23N3S2/c1-4-6-13-12-14-9-11(17-12)10-15(2)7-5-8-16-3/h9H,4-8,10H2,1-3H3,(H,13,14) |
| InChIKey | MTWXFRHUOIBGDM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|