About [5-(methylamino)-1,3,4-thiadiazol-2-yl]-(4-methylsulfanylpiperidin-1-yl)methanone
[5-(methylamino)-1,3,4-thiadiazol-2-yl]-(4-methylsulfanylpiperidin-1-yl)methanone (PubChem CID 114238331) has the molecular formula C10H16N4OS2
and a molecular weight of 272.40 g/mol. Its IUPAC name is [5-(methylamino)-1,3,4-thiadiazol-2-yl]-(4-methylsulfanylpiperidin-1-yl)methanone.
Molecular Properties
| Compound Name | [5-(methylamino)-1,3,4-thiadiazol-2-yl]-(4-methylsulfanylpiperidin-1-yl)methanone |
| PubChem CID | 114238331 |
| Molecular Formula | C10H16N4OS2 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | [5-(methylamino)-1,3,4-thiadiazol-2-yl]-(4-methylsulfanylpiperidin-1-yl)methanone |
| SMILES | CNc1nnc(C(=O)N2CCC(SC)CC2)s1 |
| InChI | InChI=1S/C10H16N4OS2/c1-11-10-13-12-8(17-10)9(15)14-5-3-7(16-2)4-6-14/h7H,3-6H2,1-2H3,(H,11,13) |
| InChIKey | QBFNJLPMYSYQQU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-(methylamino)-1,3,4-thiadiazol-2-yl]-(4-methylsulfanylpiperidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(methylamino)-1,3,4-thiadiazol-2-yl]-(4-methylsulfanylpiperidin-1-yl)methanone?
The IUPAC name of [5-(methylamino)-1,3,4-thiadiazol-2-yl]-(4-methylsulfanylpiperidin-1-yl)methanone (CID 114238331) is [5-(methylamino)-1,3,4-thiadiazol-2-yl]-(4-methylsulfanylpiperidin-1-yl)methanone.
What is the SMILES notation for [5-(methylamino)-1,3,4-thiadiazol-2-yl]-(4-methylsulfanylpiperidin-1-yl)methanone?
The canonical SMILES for [5-(methylamino)-1,3,4-thiadiazol-2-yl]-(4-methylsulfanylpiperidin-1-yl)methanone is CNc1nnc(C(=O)N2CCC(SC)CC2)s1.
What is the InChIKey of [5-(methylamino)-1,3,4-thiadiazol-2-yl]-(4-methylsulfanylpiperidin-1-yl)methanone?
The InChIKey is QBFNJLPMYSYQQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4OS2/c1-11-10-13-12-8(17-10)9(15)14-5-3-7(16-2)4-6-14/h7H,3-6H2,1-2H3,(H,11,13).
What are the key properties of [5-(methylamino)-1,3,4-thiadiazol-2-yl]-(4-methylsulfanylpiperidin-1-yl)methanone?
[5-(methylamino)-1,3,4-thiadiazol-2-yl]-(4-methylsulfanylpiperidin-1-yl)methanone has a molecular weight of 272.40 g/mol, XLogP of 1.55, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(methylamino)-1,3,4-thiadiazol-2-yl]-(4-methylsulfanylpiperidin-1-yl)methanone is sourced from PubChem (CID 114238331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).