About (4S)-4-hydroxy-5,5-dimethoxy-2-methylidenepentanenitrile
(4S)-4-hydroxy-5,5-dimethoxy-2-methylidenepentanenitrile (PubChem CID 11423836) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is (4S)-4-hydroxy-5,5-dimethoxy-2-methylidenepentanenitrile.
Molecular Properties
| Compound Name | (4S)-4-hydroxy-5,5-dimethoxy-2-methylidenepentanenitrile |
| PubChem CID | 11423836 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (4S)-4-hydroxy-5,5-dimethoxy-2-methylidenepentanenitrile |
| SMILES | C=C(C#N)C[C@H](O)C(OC)OC |
| InChI | InChI=1S/C8H13NO3/c1-6(5-9)4-7(10)8(11-2)12-3/h7-8,10H,1,4H2,2-3H3/t7-/m0/s1 |
| InChIKey | ILODXHHPHPXVPT-ZETCQYMHSA-N |
| XLogP | 0.44 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-hydroxy-5,5-dimethoxy-2-methylidenepentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-hydroxy-5,5-dimethoxy-2-methylidenepentanenitrile?
The IUPAC name of (4S)-4-hydroxy-5,5-dimethoxy-2-methylidenepentanenitrile (CID 11423836) is (4S)-4-hydroxy-5,5-dimethoxy-2-methylidenepentanenitrile.
What is the SMILES notation for (4S)-4-hydroxy-5,5-dimethoxy-2-methylidenepentanenitrile?
The canonical SMILES for (4S)-4-hydroxy-5,5-dimethoxy-2-methylidenepentanenitrile is C=C(C#N)C[C@H](O)C(OC)OC.
What is the InChIKey of (4S)-4-hydroxy-5,5-dimethoxy-2-methylidenepentanenitrile?
The InChIKey is ILODXHHPHPXVPT-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H13NO3/c1-6(5-9)4-7(10)8(11-2)12-3/h7-8,10H,1,4H2,2-3H3/t7-/m0/s1.
What are the key properties of (4S)-4-hydroxy-5,5-dimethoxy-2-methylidenepentanenitrile?
(4S)-4-hydroxy-5,5-dimethoxy-2-methylidenepentanenitrile has a molecular weight of 171.20 g/mol, XLogP of 0.44, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-hydroxy-5,5-dimethoxy-2-methylidenepentanenitrile is sourced from PubChem (CID 11423836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).