C13H28N2OS — CID 114238378
N'-methyl-N'-(3-methylsulfanylpropyl)-N-[1-(oxolan-2-yl)ethyl]ethane-1,2-diamine (PubChem CID 114238378) has the molecular formula C13H28N2OS and a molecular weight of 260.45 g/mol. Its IUPAC name is N'-methyl-N'-(3-methylsulfanylpropyl)-N-[1-(oxolan-2-yl)ethyl]ethane-1,2-diamine.
| Compound Name | N'-methyl-N'-(3-methylsulfanylpropyl)-N-[1-(oxolan-2-yl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 114238378 |
| Molecular Formula | C13H28N2OS |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | N'-methyl-N'-(3-methylsulfanylpropyl)-N-[1-(oxolan-2-yl)ethyl]ethane-1,2-diamine |
| SMILES | CSCCCN(C)CCNC(C)C1CCCO1 |
| InChI | InChI=1S/C13H28N2OS/c1-12(13-6-4-10-16-13)14-7-9-15(2)8-5-11-17-3/h12-14H,4-11H2,1-3H3 |
| InChIKey | PLGQFZJJXVPFPT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|