C12H20N2OS2 — CID 114238457
2-[methyl(3-methylsulfanylpropyl)amino]-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol (PubChem CID 114238457) has the molecular formula C12H20N2OS2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 2-[methyl(3-methylsulfanylpropyl)amino]-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol.
| Compound Name | 2-[methyl(3-methylsulfanylpropyl)amino]-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol |
|---|---|
| PubChem CID | 114238457 |
| Molecular Formula | C12H20N2OS2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-[methyl(3-methylsulfanylpropyl)amino]-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol |
| SMILES | CSCCCN(C)c1nc2c(s1)CCCC2O |
| InChI | InChI=1S/C12H20N2OS2/c1-14(7-4-8-16-2)12-13-11-9(15)5-3-6-10(11)17-12/h9,15H,3-8H2,1-2H3 |
| InChIKey | FCAQHBSGLHTLIK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|