About 3-(5-methyl-1,2,4-oxadiazol-3-yl)aniline
3-(5-methyl-1,2,4-oxadiazol-3-yl)aniline (PubChem CID 11423869) has the molecular formula C9H9N3O
and a molecular weight of 175.19 g/mol. Its IUPAC name is 3-(5-methyl-1,2,4-oxadiazol-3-yl)aniline.
Molecular Properties
| Compound Name | 3-(5-methyl-1,2,4-oxadiazol-3-yl)aniline |
| PubChem CID | 11423869 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 3-(5-methyl-1,2,4-oxadiazol-3-yl)aniline |
| SMILES | Cc1nc(-c2cccc(N)c2)no1 |
| InChI | InChI=1S/C9H9N3O/c1-6-11-9(12-13-6)7-3-2-4-8(10)5-7/h2-5H,10H2,1H3 |
| InChIKey | CTRGRIHPFAVSOF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-methyl-1,2,4-oxadiazol-3-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-methyl-1,2,4-oxadiazol-3-yl)aniline?
The IUPAC name of 3-(5-methyl-1,2,4-oxadiazol-3-yl)aniline (CID 11423869) is 3-(5-methyl-1,2,4-oxadiazol-3-yl)aniline.
What is the SMILES notation for 3-(5-methyl-1,2,4-oxadiazol-3-yl)aniline?
The canonical SMILES for 3-(5-methyl-1,2,4-oxadiazol-3-yl)aniline is Cc1nc(-c2cccc(N)c2)no1.
What is the InChIKey of 3-(5-methyl-1,2,4-oxadiazol-3-yl)aniline?
The InChIKey is CTRGRIHPFAVSOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O/c1-6-11-9(12-13-6)7-3-2-4-8(10)5-7/h2-5H,10H2,1H3.
What are the key properties of 3-(5-methyl-1,2,4-oxadiazol-3-yl)aniline?
3-(5-methyl-1,2,4-oxadiazol-3-yl)aniline has a molecular weight of 175.19 g/mol, XLogP of 1.63, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-methyl-1,2,4-oxadiazol-3-yl)aniline is sourced from PubChem (CID 11423869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).