C13H15ClN2O2 — CID 114238930
1-(3-chloro-4-hydroxyanilino)-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 114238930) has the molecular formula C13H15ClN2O2 and a molecular weight of 266.73 g/mol. Its IUPAC name is 1-(3-chloro-4-hydroxyanilino)-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | 1-(3-chloro-4-hydroxyanilino)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 114238930 |
| Molecular Formula | C13H15ClN2O2 |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 1-(3-chloro-4-hydroxyanilino)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | O=C1CC(Nc2ccc(O)c(Cl)c2)C2CCCN12 |
| InChI | InChI=1S/C13H15ClN2O2/c14-9-6-8(3-4-12(9)17)15-10-7-13(18)16-5-1-2-11(10)16/h3-4,6,10-11,15,17H,1-2,5,7H2 |
| InChIKey | RXUOYLJJRYRKCO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|