C12H17F2NO4 — CID 114239149
ethyl 2,2-difluoro-2-(1-hydroxy-3-oxo-2,5,6,7,8,8a-hexahydroindolizin-1-yl)acetate (PubChem CID 114239149) has the molecular formula C12H17F2NO4 and a molecular weight of 277.27 g/mol. Its IUPAC name is ethyl 2,2-difluoro-2-(1-hydroxy-3-oxo-2,5,6,7,8,8a-hexahydroindolizin-1-yl)acetate.
| Compound Name | ethyl 2,2-difluoro-2-(1-hydroxy-3-oxo-2,5,6,7,8,8a-hexahydroindolizin-1-yl)acetate |
|---|---|
| PubChem CID | 114239149 |
| Molecular Formula | C12H17F2NO4 |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | ethyl 2,2-difluoro-2-(1-hydroxy-3-oxo-2,5,6,7,8,8a-hexahydroindolizin-1-yl)acetate |
| SMILES | CCOC(=O)C(F)(F)C1(O)CC(=O)N2CCCCC21 |
| InChI | InChI=1S/C12H17F2NO4/c1-2-19-10(17)12(13,14)11(18)7-9(16)15-6-4-3-5-8(11)15/h8,18H,2-7H2,1H3 |
| InChIKey | IVNXFCOUXVIRAR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |