C11H23N3O3S — CID 114239295
5-[(1-methylsulfonylpiperidin-4-yl)amino]pentanamide (PubChem CID 114239295) has the molecular formula C11H23N3O3S and a molecular weight of 277.39 g/mol. Its IUPAC name is 5-[(1-methylsulfonylpiperidin-4-yl)amino]pentanamide.
| Compound Name | 5-[(1-methylsulfonylpiperidin-4-yl)amino]pentanamide |
|---|---|
| PubChem CID | 114239295 |
| Molecular Formula | C11H23N3O3S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 5-[(1-methylsulfonylpiperidin-4-yl)amino]pentanamide |
| SMILES | CS(=O)(=O)N1CCC(NCCCCC(N)=O)CC1 |
| InChI | InChI=1S/C11H23N3O3S/c1-18(16,17)14-8-5-10(6-9-14)13-7-3-2-4-11(12)15/h10,13H,2-9H2,1H3,(H2,12,15) |
| InChIKey | KJMNGNBTSRTVOH-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|