About hexyl azocane-2-carboxylate
hexyl azocane-2-carboxylate (PubChem CID 114239843) has the molecular formula C14H27NO2
and a molecular weight of 241.37 g/mol. Its IUPAC name is hexyl azocane-2-carboxylate.
Molecular Properties
| Compound Name | hexyl azocane-2-carboxylate |
| PubChem CID | 114239843 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | hexyl azocane-2-carboxylate |
| SMILES | CCCCCCOC(=O)C1CCCCCCN1 |
| InChI | InChI=1S/C14H27NO2/c1-2-3-4-9-12-17-14(16)13-10-7-5-6-8-11-15-13/h13,15H,2-12H2,1H3 |
| InChIKey | MUICQHNOMFIJQY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexyl azocane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl azocane-2-carboxylate?
The IUPAC name of hexyl azocane-2-carboxylate (CID 114239843) is hexyl azocane-2-carboxylate.
What is the SMILES notation for hexyl azocane-2-carboxylate?
The canonical SMILES for hexyl azocane-2-carboxylate is CCCCCCOC(=O)C1CCCCCCN1.
What is the InChIKey of hexyl azocane-2-carboxylate?
The InChIKey is MUICQHNOMFIJQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO2/c1-2-3-4-9-12-17-14(16)13-10-7-5-6-8-11-15-13/h13,15H,2-12H2,1H3.
What are the key properties of hexyl azocane-2-carboxylate?
hexyl azocane-2-carboxylate has a molecular weight of 241.37 g/mol, XLogP of 3.03, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl azocane-2-carboxylate is sourced from PubChem (CID 114239843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).