About Borane Diisoamyl Sulfide
Borane Diisoamyl Sulfide (PubChem CID 11424019) has the molecular formula C10H22BS
and a molecular weight of 185.17 g/mol.
Molecular Properties
| Compound Name | Borane Diisoamyl Sulfide |
| PubChem CID | 11424019 |
| Molecular Formula | C10H22BS |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | — |
| SMILES | CC(C)CCSCCC(C)C.[B] |
| InChI | InChI=1S/C10H22S.B/c1-9(2)5-7-11-8-6-10(3)4;/h9-10H,5-8H2,1-4H3; |
| InChIKey | MCVWVIORQZOVDO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Borane Diisoamyl Sulfide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Borane Diisoamyl Sulfide?
The IUPAC name of Borane Diisoamyl Sulfide (CID 11424019) is not available.
What is the SMILES notation for Borane Diisoamyl Sulfide?
The canonical SMILES for Borane Diisoamyl Sulfide is CC(C)CCSCCC(C)C.[B].
What is the InChIKey of Borane Diisoamyl Sulfide?
The InChIKey is MCVWVIORQZOVDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22S.B/c1-9(2)5-7-11-8-6-10(3)4;/h9-10H,5-8H2,1-4H3;.
What are the key properties of Borane Diisoamyl Sulfide?
Borane Diisoamyl Sulfide has a molecular weight of 185.17 g/mol, XLogP of 3.43, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Borane Diisoamyl Sulfide is sourced from PubChem (CID 11424019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).