C13H26N2O2 — CID 114240524
4-(aminomethyl)-N,3-dimethyl-N-(oxan-4-yl)oxan-4-amine (PubChem CID 114240524) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 4-(aminomethyl)-N,3-dimethyl-N-(oxan-4-yl)oxan-4-amine.
| Compound Name | 4-(aminomethyl)-N,3-dimethyl-N-(oxan-4-yl)oxan-4-amine |
|---|---|
| PubChem CID | 114240524 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 4-(aminomethyl)-N,3-dimethyl-N-(oxan-4-yl)oxan-4-amine |
| SMILES | CC1COCCC1(CN)N(C)C1CCOCC1 |
| InChI | InChI=1S/C13H26N2O2/c1-11-9-17-8-5-13(11,10-14)15(2)12-3-6-16-7-4-12/h11-12H,3-10,14H2,1-2H3 |
| InChIKey | BZRQSDAIEQWLPY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |