About (5Z)-2-fluoro-9,10-dihydro-8H-benzo[8]annulen-7-one
(5Z)-2-fluoro-9,10-dihydro-8H-benzo[8]annulen-7-one (PubChem CID 11424054) has the molecular formula C12H11FO
and a molecular weight of 190.22 g/mol. Its IUPAC name is (5Z)-2-fluoro-9,10-dihydro-8H-benzo[8]annulen-7-one.
Molecular Properties
| Compound Name | (5Z)-2-fluoro-9,10-dihydro-8H-benzo[8]annulen-7-one |
| PubChem CID | 11424054 |
| Molecular Formula | C12H11FO |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | (5Z)-2-fluoro-9,10-dihydro-8H-benzo[8]annulen-7-one |
| SMILES | O=C1/C=C\c2ccc(F)cc2CCC1 |
| InChI | InChI=1S/C12H11FO/c13-11-6-4-9-5-7-12(14)3-1-2-10(9)8-11/h4-8H,1-3H2/b7-5- |
| InChIKey | RNAZSWRXOGCWNE-ALCCZGGFSA-N |
| XLogP | 2.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5Z)-2-fluoro-9,10-dihydro-8H-benzo[8]annulen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-2-fluoro-9,10-dihydro-8H-benzo[8]annulen-7-one?
The IUPAC name of (5Z)-2-fluoro-9,10-dihydro-8H-benzo[8]annulen-7-one (CID 11424054) is (5Z)-2-fluoro-9,10-dihydro-8H-benzo[8]annulen-7-one.
What is the SMILES notation for (5Z)-2-fluoro-9,10-dihydro-8H-benzo[8]annulen-7-one?
The canonical SMILES for (5Z)-2-fluoro-9,10-dihydro-8H-benzo[8]annulen-7-one is O=C1/C=C\c2ccc(F)cc2CCC1.
What is the InChIKey of (5Z)-2-fluoro-9,10-dihydro-8H-benzo[8]annulen-7-one?
The InChIKey is RNAZSWRXOGCWNE-ALCCZGGFSA-N. The full InChI is InChI=1S/C12H11FO/c13-11-6-4-9-5-7-12(14)3-1-2-10(9)8-11/h4-8H,1-3H2/b7-5-.
What are the key properties of (5Z)-2-fluoro-9,10-dihydro-8H-benzo[8]annulen-7-one?
(5Z)-2-fluoro-9,10-dihydro-8H-benzo[8]annulen-7-one has a molecular weight of 190.22 g/mol, XLogP of 2.74, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-2-fluoro-9,10-dihydro-8H-benzo[8]annulen-7-one is sourced from PubChem (CID 11424054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).