About 1-(4-chlorophenyl)-2,2-difluoroethanone
1-(4-chlorophenyl)-2,2-difluoroethanone (PubChem CID 11424072) has the molecular formula C8H5ClF2O
and a molecular weight of 190.58 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,2-difluoroethanone.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-2,2-difluoroethanone |
| PubChem CID | 11424072 |
| Molecular Formula | C8H5ClF2O |
| Molecular Weight | 190.58 g/mol |
| Exact Mass | 190.00 |
| IUPAC Name | 1-(4-chlorophenyl)-2,2-difluoroethanone |
| SMILES | O=C(c1ccc(Cl)cc1)C(F)F |
| InChI | InChI=1S/C8H5ClF2O/c9-6-3-1-5(2-4-6)7(12)8(10)11/h1-4,8H |
| InChIKey | UVQWPRFEOFCDLY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.58 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-chlorophenyl)-2,2-difluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-2,2-difluoroethanone?
The IUPAC name of 1-(4-chlorophenyl)-2,2-difluoroethanone (CID 11424072) is 1-(4-chlorophenyl)-2,2-difluoroethanone.
What is the SMILES notation for 1-(4-chlorophenyl)-2,2-difluoroethanone?
The canonical SMILES for 1-(4-chlorophenyl)-2,2-difluoroethanone is O=C(c1ccc(Cl)cc1)C(F)F.
What is the InChIKey of 1-(4-chlorophenyl)-2,2-difluoroethanone?
The InChIKey is UVQWPRFEOFCDLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClF2O/c9-6-3-1-5(2-4-6)7(12)8(10)11/h1-4,8H.
What are the key properties of 1-(4-chlorophenyl)-2,2-difluoroethanone?
1-(4-chlorophenyl)-2,2-difluoroethanone has a molecular weight of 190.58 g/mol, XLogP of 2.79, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-2,2-difluoroethanone is sourced from PubChem (CID 11424072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).