C13H18O2 — CID 11424298
(3S,3aR,7S,8aS)-6-ethenyl-3,7-dimethyl-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-2-one (PubChem CID 11424298) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (3S,3aR,7S,8aS)-6-ethenyl-3,7-dimethyl-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-2-one.
| Compound Name | (3S,3aR,7S,8aS)-6-ethenyl-3,7-dimethyl-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-2-one |
|---|---|
| PubChem CID | 11424298 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (3S,3aR,7S,8aS)-6-ethenyl-3,7-dimethyl-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-2-one |
| SMILES | C=CC1=CC[C@H]2[C@H](C[C@@H]1C)OC(=O)[C@H]2C |
| InChI | InChI=1S/C13H18O2/c1-4-10-5-6-11-9(3)13(14)15-12(11)7-8(10)2/h4-5,8-9,11-12H,1,6-7H2,2-3H3/t8-,9-,11+,12-/m0/s1 |
| InChIKey | QQPKFFIULVROQD-XPXLGCRWSA-N |
| XLogP | 2.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |