C12H21BrN2O2S — CID 114243019
2-[2-[[2-amino-1-(4-bromothiophen-2-yl)propyl]-methylamino]ethoxy]ethanol (PubChem CID 114243019) has the molecular formula C12H21BrN2O2S and a molecular weight of 337.28 g/mol. Its IUPAC name is 2-[2-[[2-amino-1-(4-bromothiophen-2-yl)propyl]-methylamino]ethoxy]ethanol.
| Compound Name | 2-[2-[[2-amino-1-(4-bromothiophen-2-yl)propyl]-methylamino]ethoxy]ethanol |
|---|---|
| PubChem CID | 114243019 |
| Molecular Formula | C12H21BrN2O2S |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 2-[2-[[2-amino-1-(4-bromothiophen-2-yl)propyl]-methylamino]ethoxy]ethanol |
| SMILES | CC(N)C(c1cc(Br)cs1)N(C)CCOCCO |
| InChI | InChI=1S/C12H21BrN2O2S/c1-9(14)12(11-7-10(13)8-18-11)15(2)3-5-17-6-4-16/h7-9,12,16H,3-6,14H2,1-2H3 |
| InChIKey | PGULPKXJRYCIPF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|