C11H23N3O4 — CID 114243599
2-[2-(2-hydroxyethoxy)ethyl-methylamino]-N-(propan-2-ylcarbamoyl)acetamide (PubChem CID 114243599) has the molecular formula C11H23N3O4 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethyl-methylamino]-N-(propan-2-ylcarbamoyl)acetamide.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethyl-methylamino]-N-(propan-2-ylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 114243599 |
| Molecular Formula | C11H23N3O4 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethyl-methylamino]-N-(propan-2-ylcarbamoyl)acetamide |
| SMILES | CC(C)NC(=O)NC(=O)CN(C)CCOCCO |
| InChI | InChI=1S/C11H23N3O4/c1-9(2)12-11(17)13-10(16)8-14(3)4-6-18-7-5-15/h9,15H,4-8H2,1-3H3,(H2,12,13,16,17) |
| InChIKey | FVSQDKXVXHPWOM-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|