About 2-[2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-methylamino]ethoxy]ethanol
2-[2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-methylamino]ethoxy]ethanol (PubChem CID 114243629) has the molecular formula C11H21N3O2S
and a molecular weight of 259.37 g/mol. Its IUPAC name is 2-[2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-methylamino]ethoxy]ethanol.
Molecular Properties
| Compound Name | 2-[2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-methylamino]ethoxy]ethanol |
| PubChem CID | 114243629 |
| Molecular Formula | C11H21N3O2S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2-[2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-methylamino]ethoxy]ethanol |
| SMILES | CCNc1ncc(CN(C)CCOCCO)s1 |
| InChI | InChI=1S/C11H21N3O2S/c1-3-12-11-13-8-10(17-11)9-14(2)4-6-16-7-5-15/h8,15H,3-7,9H2,1-2H3,(H,12,13) |
| InChIKey | REKJLNKNQVQRRE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-methylamino]ethoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-methylamino]ethoxy]ethanol?
The IUPAC name of 2-[2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-methylamino]ethoxy]ethanol (CID 114243629) is 2-[2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-methylamino]ethoxy]ethanol.
What is the SMILES notation for 2-[2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-methylamino]ethoxy]ethanol?
The canonical SMILES for 2-[2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-methylamino]ethoxy]ethanol is CCNc1ncc(CN(C)CCOCCO)s1.
What is the InChIKey of 2-[2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-methylamino]ethoxy]ethanol?
The InChIKey is REKJLNKNQVQRRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O2S/c1-3-12-11-13-8-10(17-11)9-14(2)4-6-16-7-5-15/h8,15H,3-7,9H2,1-2H3,(H,12,13).
What are the key properties of 2-[2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-methylamino]ethoxy]ethanol?
2-[2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-methylamino]ethoxy]ethanol has a molecular weight of 259.37 g/mol, XLogP of 1.02, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-methylamino]ethoxy]ethanol is sourced from PubChem (CID 114243629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).