C13H27NO3 — CID 114243666
2-[2-[[1-(hydroxymethyl)cyclohexyl]methyl-methylamino]ethoxy]ethanol (PubChem CID 114243666) has the molecular formula C13H27NO3 and a molecular weight of 245.36 g/mol. Its IUPAC name is 2-[2-[[1-(hydroxymethyl)cyclohexyl]methyl-methylamino]ethoxy]ethanol.
| Compound Name | 2-[2-[[1-(hydroxymethyl)cyclohexyl]methyl-methylamino]ethoxy]ethanol |
|---|---|
| PubChem CID | 114243666 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | 2-[2-[[1-(hydroxymethyl)cyclohexyl]methyl-methylamino]ethoxy]ethanol |
| SMILES | CN(CCOCCO)CC1(CO)CCCCC1 |
| InChI | InChI=1S/C13H27NO3/c1-14(7-9-17-10-8-15)11-13(12-16)5-3-2-4-6-13/h15-16H,2-12H2,1H3 |
| InChIKey | HZMFVXJNPKNIHX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|