About 2-[[2-(2-aminoethoxy)ethyl-methylsulfamoyl]amino]-1,1,1-trifluoroethane
2-[[2-(2-aminoethoxy)ethyl-methylsulfamoyl]amino]-1,1,1-trifluoroethane (PubChem CID 114243748) has the molecular formula C7H16F3N3O3S
and a molecular weight of 279.28 g/mol. Its IUPAC name is 2-[[2-(2-aminoethoxy)ethyl-methylsulfamoyl]amino]-1,1,1-trifluoroethane.
Molecular Properties
| Compound Name | 2-[[2-(2-aminoethoxy)ethyl-methylsulfamoyl]amino]-1,1,1-trifluoroethane |
| PubChem CID | 114243748 |
| Molecular Formula | C7H16F3N3O3S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-[[2-(2-aminoethoxy)ethyl-methylsulfamoyl]amino]-1,1,1-trifluoroethane |
| SMILES | CN(CCOCCN)S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H16F3N3O3S/c1-13(3-5-16-4-2-11)17(14,15)12-6-7(8,9)10/h12H,2-6,11H2,1H3 |
| InChIKey | YFEKINCWLICLAL-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-(2-aminoethoxy)ethyl-methylsulfamoyl]amino]-1,1,1-trifluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(2-aminoethoxy)ethyl-methylsulfamoyl]amino]-1,1,1-trifluoroethane?
The IUPAC name of 2-[[2-(2-aminoethoxy)ethyl-methylsulfamoyl]amino]-1,1,1-trifluoroethane (CID 114243748) is 2-[[2-(2-aminoethoxy)ethyl-methylsulfamoyl]amino]-1,1,1-trifluoroethane.
What is the SMILES notation for 2-[[2-(2-aminoethoxy)ethyl-methylsulfamoyl]amino]-1,1,1-trifluoroethane?
The canonical SMILES for 2-[[2-(2-aminoethoxy)ethyl-methylsulfamoyl]amino]-1,1,1-trifluoroethane is CN(CCOCCN)S(=O)(=O)NCC(F)(F)F.
What is the InChIKey of 2-[[2-(2-aminoethoxy)ethyl-methylsulfamoyl]amino]-1,1,1-trifluoroethane?
The InChIKey is YFEKINCWLICLAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16F3N3O3S/c1-13(3-5-16-4-2-11)17(14,15)12-6-7(8,9)10/h12H,2-6,11H2,1H3.
What are the key properties of 2-[[2-(2-aminoethoxy)ethyl-methylsulfamoyl]amino]-1,1,1-trifluoroethane?
2-[[2-(2-aminoethoxy)ethyl-methylsulfamoyl]amino]-1,1,1-trifluoroethane has a molecular weight of 279.28 g/mol, XLogP of -0.71, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(2-aminoethoxy)ethyl-methylsulfamoyl]amino]-1,1,1-trifluoroethane is sourced from PubChem (CID 114243748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).