C13H17N5 — CID 114244272
N,N-dimethyl-5-(1,2,3,4-tetrahydroisoquinolin-3-yl)-1H-1,2,4-triazol-3-amine (PubChem CID 114244272) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is N,N-dimethyl-5-(1,2,3,4-tetrahydroisoquinolin-3-yl)-1H-1,2,4-triazol-3-amine.
| Compound Name | N,N-dimethyl-5-(1,2,3,4-tetrahydroisoquinolin-3-yl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 114244272 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | N,N-dimethyl-5-(1,2,3,4-tetrahydroisoquinolin-3-yl)-1H-1,2,4-triazol-3-amine |
| SMILES | CN(C)c1n[nH]c(C2Cc3ccccc3CN2)n1 |
| InChI | InChI=1S/C13H17N5/c1-18(2)13-15-12(16-17-13)11-7-9-5-3-4-6-10(9)8-14-11/h3-6,11,14H,7-8H2,1-2H3,(H,15,16,17) |
| InChIKey | NMZKRXPPOHKPNO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |