About [(2S)-2-[(1R,2S,4S)-2-hydroxy-4-methylcyclohexyl]propyl] acetate
[(2S)-2-[(1R,2S,4S)-2-hydroxy-4-methylcyclohexyl]propyl] acetate (PubChem CID 11424439) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is [(2S)-2-[(1R,2S,4S)-2-hydroxy-4-methylcyclohexyl]propyl] acetate.
Molecular Properties
| Compound Name | [(2S)-2-[(1R,2S,4S)-2-hydroxy-4-methylcyclohexyl]propyl] acetate |
| PubChem CID | 11424439 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | [(2S)-2-[(1R,2S,4S)-2-hydroxy-4-methylcyclohexyl]propyl] acetate |
| SMILES | CC(=O)OC[C@@H](C)[C@H]1CC[C@H](C)C[C@@H]1O |
| InChI | InChI=1S/C12H22O3/c1-8-4-5-11(12(14)6-8)9(2)7-15-10(3)13/h8-9,11-12,14H,4-7H2,1-3H3/t8-,9+,11+,12-/m0/s1 |
| InChIKey | AXWWKLJGEVNORD-SPFNVWMYSA-N |
| XLogP | 1.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-2-[(1R,2S,4S)-2-hydroxy-4-methylcyclohexyl]propyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-[(1R,2S,4S)-2-hydroxy-4-methylcyclohexyl]propyl] acetate?
The IUPAC name of [(2S)-2-[(1R,2S,4S)-2-hydroxy-4-methylcyclohexyl]propyl] acetate (CID 11424439) is [(2S)-2-[(1R,2S,4S)-2-hydroxy-4-methylcyclohexyl]propyl] acetate.
What is the SMILES notation for [(2S)-2-[(1R,2S,4S)-2-hydroxy-4-methylcyclohexyl]propyl] acetate?
The canonical SMILES for [(2S)-2-[(1R,2S,4S)-2-hydroxy-4-methylcyclohexyl]propyl] acetate is CC(=O)OC[C@@H](C)[C@H]1CC[C@H](C)C[C@@H]1O.
What is the InChIKey of [(2S)-2-[(1R,2S,4S)-2-hydroxy-4-methylcyclohexyl]propyl] acetate?
The InChIKey is AXWWKLJGEVNORD-SPFNVWMYSA-N. The full InChI is InChI=1S/C12H22O3/c1-8-4-5-11(12(14)6-8)9(2)7-15-10(3)13/h8-9,11-12,14H,4-7H2,1-3H3/t8-,9+,11+,12-/m0/s1.
What are the key properties of [(2S)-2-[(1R,2S,4S)-2-hydroxy-4-methylcyclohexyl]propyl] acetate?
[(2S)-2-[(1R,2S,4S)-2-hydroxy-4-methylcyclohexyl]propyl] acetate has a molecular weight of 214.30 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-[(1R,2S,4S)-2-hydroxy-4-methylcyclohexyl]propyl] acetate is sourced from PubChem (CID 11424439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).