C11H18O5 — CID 11424723
(3R,5S,6S)-5,6-dimethoxy-5,6-dimethyl-3-prop-2-enyl-1,4-dioxan-2-one (PubChem CID 11424723) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is (3R,5S,6S)-5,6-dimethoxy-5,6-dimethyl-3-prop-2-enyl-1,4-dioxan-2-one.
| Compound Name | (3R,5S,6S)-5,6-dimethoxy-5,6-dimethyl-3-prop-2-enyl-1,4-dioxan-2-one |
|---|---|
| PubChem CID | 11424723 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (3R,5S,6S)-5,6-dimethoxy-5,6-dimethyl-3-prop-2-enyl-1,4-dioxan-2-one |
| SMILES | C=CC[C@H]1O[C@](C)(OC)[C@@](C)(OC)OC1=O |
| InChI | InChI=1S/C11H18O5/c1-6-7-8-9(12)16-11(3,14-5)10(2,13-4)15-8/h6,8H,1,7H2,2-5H3/t8-,10+,11+/m1/s1 |
| InChIKey | BJELISUNQBSMGB-MIMYLULJSA-N |
| XLogP | 1.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|