About 4-(4-amino-3,3-dimethylbutyl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol
4-(4-amino-3,3-dimethylbutyl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol (PubChem CID 114247361) has the molecular formula C14H26N2O
and a molecular weight of 238.37 g/mol. Its IUPAC name is 4-(4-amino-3,3-dimethylbutyl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol.
Molecular Properties
| Compound Name | 4-(4-amino-3,3-dimethylbutyl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol |
| PubChem CID | 114247361 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 4-(4-amino-3,3-dimethylbutyl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol |
| SMILES | CC(C)(CN)CCN1CC2CC3CC2C1C3O |
| InChI | InChI=1S/C14H26N2O/c1-14(2,8-15)3-4-16-7-10-5-9-6-11(10)12(16)13(9)17/h9-13,17H,3-8,15H2,1-2H3 |
| InChIKey | CZQPKDUYNWJWEO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-amino-3,3-dimethylbutyl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-amino-3,3-dimethylbutyl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol?
The IUPAC name of 4-(4-amino-3,3-dimethylbutyl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol (CID 114247361) is 4-(4-amino-3,3-dimethylbutyl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol.
What is the SMILES notation for 4-(4-amino-3,3-dimethylbutyl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol?
The canonical SMILES for 4-(4-amino-3,3-dimethylbutyl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol is CC(C)(CN)CCN1CC2CC3CC2C1C3O.
What is the InChIKey of 4-(4-amino-3,3-dimethylbutyl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol?
The InChIKey is CZQPKDUYNWJWEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O/c1-14(2,8-15)3-4-16-7-10-5-9-6-11(10)12(16)13(9)17/h9-13,17H,3-8,15H2,1-2H3.
What are the key properties of 4-(4-amino-3,3-dimethylbutyl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol?
4-(4-amino-3,3-dimethylbutyl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol has a molecular weight of 238.37 g/mol, XLogP of 1.06, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-amino-3,3-dimethylbutyl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol is sourced from PubChem (CID 114247361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).